C9H17N2+ — CID 154065056
4-butyl-1,2-dimethyl-1H-imidazol-1-ium (PubChem CID 154065056) has the molecular formula C9H17N2+ and a molecular weight of 153.25 g/mol. Its IUPAC name is 4-butyl-1,2-dimethyl-1H-imidazol-1-ium.
| Compound Name | 4-butyl-1,2-dimethyl-1H-imidazol-1-ium |
|---|---|
| PubChem CID | 154065056 |
| Molecular Formula | C9H17N2+ |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.14 |
| IUPAC Name | 4-butyl-1,2-dimethyl-1H-imidazol-1-ium |
| SMILES | CCCCC1=C[NH+](C)C(C)=N1 |
| InChI | InChI=1S/C9H16N2/c1-4-5-6-9-7-11(3)8(2)10-9/h7H,4-6H2,1-3H3/p+1 |
| InChIKey | SUBVGNRMHBPVTI-UHFFFAOYSA-O |
| XLogP | 0.96 |
| TPSA | 16.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |