C7H13N2+ — CID 154104252
4-ethyl-1,2-dimethyl-1H-imidazol-1-ium (PubChem CID 154104252) has the molecular formula C7H13N2+ and a molecular weight of 125.19 g/mol. Its IUPAC name is 4-ethyl-1,2-dimethyl-1H-imidazol-1-ium.
| Compound Name | 4-ethyl-1,2-dimethyl-1H-imidazol-1-ium |
|---|---|
| PubChem CID | 154104252 |
| Molecular Formula | C7H13N2+ |
| Molecular Weight | 125.19 g/mol |
| Exact Mass | 125.11 |
| IUPAC Name | 4-ethyl-1,2-dimethyl-1H-imidazol-1-ium |
| SMILES | CCC1=C[NH+](C)C(C)=N1 |
| InChI | InChI=1S/C7H12N2/c1-4-7-5-9(3)6(2)8-7/h5H,4H2,1-3H3/p+1 |
| InChIKey | GEFNFZTUZOXURZ-UHFFFAOYSA-O |
| XLogP | 0.18 |
| TPSA | 16.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.19 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |