C25H23N3O8 — CID 136504143
acetyloxymethyl 2-(2,5-dimethylpyrrol-1-yl)-4-[[(E)-(4-hydroxy-1,3-benzodioxol-5-yl)methylideneamino]carbamoyl]benzoate (PubChem CID 136504143) has the molecular formula C25H23N3O8 and a molecular weight of 493.47 g/mol. Its IUPAC name is acetyloxymethyl 2-(2,5-dimethylpyrrol-1-yl)-4-[[(E)-(4-hydroxy-1,3-benzodioxol-5-yl)methylideneamino]carbamoyl]benzoate.
| Compound Name | acetyloxymethyl 2-(2,5-dimethylpyrrol-1-yl)-4-[[(E)-(4-hydroxy-1,3-benzodioxol-5-yl)methylideneamino]carbamoyl]benzoate |
|---|---|
| PubChem CID | 136504143 |
| Molecular Formula | C25H23N3O8 |
| Molecular Weight | 493.47 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | acetyloxymethyl 2-(2,5-dimethylpyrrol-1-yl)-4-[[(E)-(4-hydroxy-1,3-benzodioxol-5-yl)methylideneamino]carbamoyl]benzoate |
| SMILES | CC(=O)OCOC(=O)c1ccc(C(=O)N/N=C/c2ccc3c(c2O)OCO3)cc1-n1c(C)ccc1C |
| InChI | InChI=1S/C25H23N3O8/c1-14-4-5-15(2)28(14)20-10-17(6-8-19(20)25(32)36-12-33-16(3)29)24(31)27-26-11-18-7-9-21-23(22(18)30)35-13-34-21/h4-11,30H,12-13H2,1-3H3,(H,27,31)/b26-11+ |
| InChIKey | YZQIKWQWJMVPOM-KBKYJPHKSA-N |
| XLogP | 2.97 |
| TPSA | 137.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|