C26H23N5O5 — CID 123592517
acetyloxymethyl 2-(2,5-dimethylpyrrol-1-yl)-4-[(1,8-naphthyridin-2-ylmethylideneamino)carbamoyl]benzoate (PubChem CID 123592517) has the molecular formula C26H23N5O5 and a molecular weight of 485.50 g/mol. Its IUPAC name is acetyloxymethyl 2-(2,5-dimethylpyrrol-1-yl)-4-[(1,8-naphthyridin-2-ylmethylideneamino)carbamoyl]benzoate.
| Compound Name | acetyloxymethyl 2-(2,5-dimethylpyrrol-1-yl)-4-[(1,8-naphthyridin-2-ylmethylideneamino)carbamoyl]benzoate |
|---|---|
| PubChem CID | 123592517 |
| Molecular Formula | C26H23N5O5 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | acetyloxymethyl 2-(2,5-dimethylpyrrol-1-yl)-4-[(1,8-naphthyridin-2-ylmethylideneamino)carbamoyl]benzoate |
| SMILES | CC(=O)OCOC(=O)c1ccc(C(=O)NN=Cc2ccc3cccnc3n2)cc1-n1c(C)ccc1C |
| InChI | InChI=1S/C26H23N5O5/c1-16-6-7-17(2)31(16)23-13-20(9-11-22(23)26(34)36-15-35-18(3)32)25(33)30-28-14-21-10-8-19-5-4-12-27-24(19)29-21/h4-14H,15H2,1-3H3,(H,30,33) |
| InChIKey | IHSLFYNDYBIHAE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|