C25H27N7O5 — CID 138510683
acetyloxymethyl 4-[[(E)-[4-[(Z)-N-aminocarbamohydrazonoyl]phenyl]methylideneamino]carbamoyl]-2-(2,5-dimethylpyrrol-1-yl)benzoate (PubChem CID 138510683) has the molecular formula C25H27N7O5 and a molecular weight of 505.54 g/mol. Its IUPAC name is acetyloxymethyl 4-[[(E)-[4-[(Z)-N-aminocarbamohydrazonoyl]phenyl]methylideneamino]carbamoyl]-2-(2,5-dimethylpyrrol-1-yl)benzoate.
| Compound Name | acetyloxymethyl 4-[[(E)-[4-[(Z)-N-aminocarbamohydrazonoyl]phenyl]methylideneamino]carbamoyl]-2-(2,5-dimethylpyrrol-1-yl)benzoate |
|---|---|
| PubChem CID | 138510683 |
| Molecular Formula | C25H27N7O5 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | acetyloxymethyl 4-[[(E)-[4-[(Z)-N-aminocarbamohydrazonoyl]phenyl]methylideneamino]carbamoyl]-2-(2,5-dimethylpyrrol-1-yl)benzoate |
| SMILES | CC(=O)OCOC(=O)c1ccc(C(=O)N/N=C/c2ccc(/C(=N/N)NN)cc2)cc1-n1c(C)ccc1C |
| InChI | InChI=1S/C25H27N7O5/c1-15-4-5-16(2)32(15)22-12-20(10-11-21(22)25(35)37-14-36-17(3)33)24(34)31-28-13-18-6-8-19(9-7-18)23(29-26)30-27/h4-13H,14,26-27H2,1-3H3,(H,29,30)(H,31,34)/b28-13+ |
| InChIKey | MPRGXTUJNXNQGI-XODNFHPESA-N |
| XLogP | 1.62 |
| TPSA | 175.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|