C11H17F3N2O4S — CID 136506885
2-propylimino-5-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 136506885) has the molecular formula C11H17F3N2O4S and a molecular weight of 330.33 g/mol. Its IUPAC name is 2-propylimino-5-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | 2-propylimino-5-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 136506885 |
| Molecular Formula | C11H17F3N2O4S |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-propylimino-5-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | CCC/N=C1/NC2C(OC([C@@H](O)C(F)(F)F)C(O)C2O)S1 |
| InChI | InChI=1S/C11H17F3N2O4S/c1-2-3-15-10-16-4-5(17)6(18)7(20-9(4)21-10)8(19)11(12,13)14/h4-9,17-19H,2-3H2,1H3,(H,15,16)/t4?,5?,6?,7?,8-,9?/m1/s1 |
| InChIKey | MGEBPZJPXKZSNB-PVLOEFSHSA-N |
| XLogP | -0.17 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|