C10H15F3N2O4S — CID 137161985
2-(2-hydroxyethylimino)-5-(2,2,2-trifluoroethyl)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 137161985) has the molecular formula C10H15F3N2O4S and a molecular weight of 316.30 g/mol. Its IUPAC name is 2-(2-hydroxyethylimino)-5-(2,2,2-trifluoroethyl)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | 2-(2-hydroxyethylimino)-5-(2,2,2-trifluoroethyl)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 137161985 |
| Molecular Formula | C10H15F3N2O4S |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-(2-hydroxyethylimino)-5-(2,2,2-trifluoroethyl)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | OCC/N=C1/NC2C(OC(CC(F)(F)F)C(O)C2O)S1 |
| InChI | InChI=1S/C10H15F3N2O4S/c11-10(12,13)3-4-6(17)7(18)5-8(19-4)20-9(15-5)14-1-2-16/h4-8,16-18H,1-3H2,(H,14,15) |
| InChIKey | QDXVWFFXCNYGBZ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|