C12H21FN2O3S — CID 137018947
5-(2-fluoropropan-2-yl)-2-propylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 137018947) has the molecular formula C12H21FN2O3S and a molecular weight of 292.38 g/mol. Its IUPAC name is 5-(2-fluoropropan-2-yl)-2-propylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | 5-(2-fluoropropan-2-yl)-2-propylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 137018947 |
| Molecular Formula | C12H21FN2O3S |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 5-(2-fluoropropan-2-yl)-2-propylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | CCC/N=C1/NC2C(OC(C(C)(C)F)C(O)C2O)S1 |
| InChI | InChI=1S/C12H21FN2O3S/c1-4-5-14-11-15-6-7(16)8(17)9(12(2,3)13)18-10(6)19-11/h6-10,16-17H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | PNZZHORRAGTSSA-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|