C23H27N5O2S — CID 136507747
3-(3-tert-butyliminospiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl)sulfonylbenzonitrile (PubChem CID 136507747) has the molecular formula C23H27N5O2S and a molecular weight of 437.57 g/mol. Its IUPAC name is 3-(3-tert-butyliminospiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl)sulfonylbenzonitrile.
| Compound Name | 3-(3-tert-butyliminospiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl)sulfonylbenzonitrile |
|---|---|
| PubChem CID | 136507747 |
| Molecular Formula | C23H27N5O2S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 3-(3-tert-butyliminospiro[1,4-dihydroquinoxaline-2,3'-piperidine]-1'-yl)sulfonylbenzonitrile |
| SMILES | CC(C)(C)/N=C1\Nc2ccccc2NC12CCCN(S(=O)(=O)c1cccc(C#N)c1)C2 |
| InChI | InChI=1S/C23H27N5O2S/c1-22(2,3)27-21-23(26-20-11-5-4-10-19(20)25-21)12-7-13-28(16-23)31(29,30)18-9-6-8-17(14-18)15-24/h4-6,8-11,14,26H,7,12-13,16H2,1-3H3,(H,25,27) |
| InChIKey | LURQRUNZRPDZKH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|