C23H16N2O4S — CID 136510579
N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-7-methoxy-1-benzofuran-2-carboxamide (PubChem CID 136510579) has the molecular formula C23H16N2O4S and a molecular weight of 416.46 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-7-methoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-7-methoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 136510579 |
| Molecular Formula | C23H16N2O4S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-7-methoxy-1-benzofuran-2-carboxamide |
| SMILES | COc1cccc2cc(C(=O)Nc3ccc(O)c(-c4nc5ccccc5s4)c3)oc12 |
| InChI | InChI=1S/C23H16N2O4S/c1-28-18-7-4-5-13-11-19(29-21(13)18)22(27)24-14-9-10-17(26)15(12-14)23-25-16-6-2-3-8-20(16)30-23/h2-12,26H,1H3,(H,24,27) |
| InChIKey | YTYWWBYSNZCEBA-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|