C18H21N3O3 — CID 136512190
5-(2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-1'-yl)-2,2-dimethylpentanenitrile (PubChem CID 136512190) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 5-(2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-1'-yl)-2,2-dimethylpentanenitrile.
| Compound Name | 5-(2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-1'-yl)-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 136512190 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 5-(2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-1'-yl)-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCN1C(=O)NC2(CCOc3ccccc32)C1=O |
| InChI | InChI=1S/C18H21N3O3/c1-17(2,12-19)8-5-10-21-15(22)18(20-16(21)23)9-11-24-14-7-4-3-6-13(14)18/h3-4,6-7H,5,8-11H2,1-2H3,(H,20,23) |
| InChIKey | KFZUFBKXTIKKCM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|