C20H17N3O4 — CID 136577003
2-[2-(2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-1'-yl)ethoxy]benzonitrile (PubChem CID 136577003) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is 2-[2-(2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-1'-yl)ethoxy]benzonitrile.
| Compound Name | 2-[2-(2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-1'-yl)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 136577003 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 2-[2-(2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-1'-yl)ethoxy]benzonitrile |
| SMILES | N#Cc1ccccc1OCCN1C(=O)NC2(CCOc3ccccc32)C1=O |
| InChI | InChI=1S/C20H17N3O4/c21-13-14-5-1-3-7-16(14)27-12-10-23-18(24)20(22-19(23)25)9-11-26-17-8-4-2-6-15(17)20/h1-8H,9-12H2,(H,22,25) |
| InChIKey | WZXVMARKPAYRJG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|