C20H29N3O2 — CID 136513230
N-[2-(3-ethyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-oxoethyl]-2-phenylacetamide (PubChem CID 136513230) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is N-[2-(3-ethyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-oxoethyl]-2-phenylacetamide.
| Compound Name | N-[2-(3-ethyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-oxoethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 136513230 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | N-[2-(3-ethyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-oxoethyl]-2-phenylacetamide |
| SMILES | CCC1CN2CCCCC2CN1C(=O)CNC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C20H29N3O2/c1-2-17-14-22-11-7-6-10-18(22)15-23(17)20(25)13-21-19(24)12-16-8-4-3-5-9-16/h3-5,8-9,17-18H,2,6-7,10-15H2,1H3,(H,21,24) |
| InChIKey | KSROGKLMUFQUGX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |