C23H20BrNO4 — CID 1365154
methyl (4S)-4-(5-bromo-2-ethoxyphenyl)-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate (PubChem CID 1365154) has the molecular formula C23H20BrNO4 and a molecular weight of 454.32 g/mol. Its IUPAC name is methyl (4S)-4-(5-bromo-2-ethoxyphenyl)-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate.
| Compound Name | methyl (4S)-4-(5-bromo-2-ethoxyphenyl)-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 1365154 |
| Molecular Formula | C23H20BrNO4 |
| Molecular Weight | 454.32 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | methyl (4S)-4-(5-bromo-2-ethoxyphenyl)-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate |
| SMILES | CCOc1ccc(Br)cc1[C@@H]1C(C(=O)OC)=C(C)NC2=C1C(=O)c1ccccc12 |
| InChI | InChI=1S/C23H20BrNO4/c1-4-29-17-10-9-13(24)11-16(17)19-18(23(27)28-3)12(2)25-21-14-7-5-6-8-15(14)22(26)20(19)21/h5-11,19,25H,4H2,1-3H3/t19-/m1/s1 |
| InChIKey | IKSWBIGJQVISFW-LJQANCHMSA-N |
| XLogP | 4.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dhp_keto_A(9)', 'substructure': 'N/A'} |
|---|