C23H19NO6 — CID 2890287
2-[2-(3-methoxycarbonyl-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridin-4-yl)phenoxy]acetic acid (PubChem CID 2890287) has the molecular formula C23H19NO6 and a molecular weight of 405.41 g/mol. Its IUPAC name is 2-[2-(3-methoxycarbonyl-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridin-4-yl)phenoxy]acetic acid.
| Compound Name | 2-[2-(3-methoxycarbonyl-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridin-4-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 2890287 |
| Molecular Formula | C23H19NO6 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 2-[2-(3-methoxycarbonyl-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridin-4-yl)phenoxy]acetic acid |
| SMILES | COC(=O)C1=C(C)NC2=C(C(=O)c3ccccc32)C1c1ccccc1OCC(=O)O |
| InChI | InChI=1S/C23H19NO6/c1-12-18(23(28)29-2)19(15-9-5-6-10-16(15)30-11-17(25)26)20-21(24-12)13-7-3-4-8-14(13)22(20)27/h3-10,19,24H,11H2,1-2H3,(H,25,26) |
| InChIKey | SGRKVVWYWKGEBK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dhp_keto_A(9)', 'substructure': 'N/A'} |
|---|