C19H15NO4 — CID 4047552
methyl 4-(furan-2-yl)-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate (PubChem CID 4047552) has the molecular formula C19H15NO4 and a molecular weight of 321.33 g/mol. Its IUPAC name is methyl 4-(furan-2-yl)-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate.
| Compound Name | methyl 4-(furan-2-yl)-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 4047552 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | methyl 4-(furan-2-yl)-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC2=C(C(=O)c3ccccc32)C1c1ccco1 |
| InChI | InChI=1S/C19H15NO4/c1-10-14(19(22)23-2)15(13-8-5-9-24-13)16-17(20-10)11-6-3-4-7-12(11)18(16)21/h3-9,15,20H,1-2H3 |
| InChIKey | NGAKXTHKHRUSJY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dhp_keto_A(9)', 'substructure': 'N/A'} |
|---|