C22H18ClNO3 — CID 5153329
ethyl 4-(2-chlorophenyl)-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate (PubChem CID 5153329) has the molecular formula C22H18ClNO3 and a molecular weight of 379.84 g/mol. Its IUPAC name is ethyl 4-(2-chlorophenyl)-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate.
| Compound Name | ethyl 4-(2-chlorophenyl)-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 5153329 |
| Molecular Formula | C22H18ClNO3 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | ethyl 4-(2-chlorophenyl)-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC2=C(C(=O)c3ccccc32)C1c1ccccc1Cl |
| InChI | InChI=1S/C22H18ClNO3/c1-3-27-22(26)17-12(2)24-20-13-8-4-5-9-14(13)21(25)19(20)18(17)15-10-6-7-11-16(15)23/h4-11,18,24H,3H2,1-2H3 |
| InChIKey | DWPHPCZDKMECHL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dhp_keto_A(9)', 'substructure': 'N/A'} |
|---|