C25H21N3O3 — CID 4048011
ethyl 2-methyl-5-oxo-4-(5-phenyl-1H-pyrazol-4-yl)-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate (PubChem CID 4048011) has the molecular formula C25H21N3O3 and a molecular weight of 411.46 g/mol. Its IUPAC name is ethyl 2-methyl-5-oxo-4-(5-phenyl-1H-pyrazol-4-yl)-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate.
| Compound Name | ethyl 2-methyl-5-oxo-4-(5-phenyl-1H-pyrazol-4-yl)-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 4048011 |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | ethyl 2-methyl-5-oxo-4-(5-phenyl-1H-pyrazol-4-yl)-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC2=C(C(=O)c3ccccc32)C1c1cn[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C25H21N3O3/c1-3-31-25(30)19-14(2)27-23-16-11-7-8-12-17(16)24(29)21(23)20(19)18-13-26-28-22(18)15-9-5-4-6-10-15/h4-13,20,27H,3H2,1-2H3,(H,26,28) |
| InChIKey | PMZYPNDXRFFZJT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dhp_keto_A(9)', 'substructure': 'N/A'} |
|---|