C18H21N3OS2 — CID 136516213
N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-(2,5-dimethyl-1,3-thiazol-4-yl)acetamide (PubChem CID 136516213) has the molecular formula C18H21N3OS2 and a molecular weight of 359.52 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-(2,5-dimethyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-(2,5-dimethyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 136516213 |
| Molecular Formula | C18H21N3OS2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-(2,5-dimethyl-1,3-thiazol-4-yl)acetamide |
| SMILES | Cc1nc(CC(=O)Nc2sc3c(c2C#N)CCCCCC3)c(C)s1 |
| InChI | InChI=1S/C18H21N3OS2/c1-11-15(20-12(2)23-11)9-17(22)21-18-14(10-19)13-7-5-3-4-6-8-16(13)24-18/h3-9H2,1-2H3,(H,21,22) |
| InChIKey | JQZAFNAQPXWADF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |