C18H34N4O3 — CID 136517705
1-[(3-hydroxyoxolan-3-yl)methyl]-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]urea (PubChem CID 136517705) has the molecular formula C18H34N4O3 and a molecular weight of 354.50 g/mol. Its IUPAC name is 1-[(3-hydroxyoxolan-3-yl)methyl]-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]urea.
| Compound Name | 1-[(3-hydroxyoxolan-3-yl)methyl]-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]urea |
|---|---|
| PubChem CID | 136517705 |
| Molecular Formula | C18H34N4O3 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | 1-[(3-hydroxyoxolan-3-yl)methyl]-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]urea |
| SMILES | CN1CCC(CNC(=O)NCC2(O)CCOC2)(N2CCCCC2)CC1 |
| InChI | InChI=1S/C18H34N4O3/c1-21-10-5-17(6-11-21,22-8-3-2-4-9-22)13-19-16(23)20-14-18(24)7-12-25-15-18/h24H,2-15H2,1H3,(H2,19,20,23) |
| InChIKey | IDOCMCSBNFSCKL-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |