About 1-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea
1-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea (PubChem CID 136524628) has the molecular formula C16H19FN4O3
and a molecular weight of 334.35 g/mol. Its IUPAC name is 1-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea.
Molecular Properties
| Compound Name | 1-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea |
| PubChem CID | 136524628 |
| Molecular Formula | C16H19FN4O3 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea |
| SMILES | COCCn1cc(NC(=O)NC2CCOc3ccc(F)cc32)cn1 |
| InChI | InChI=1S/C16H19FN4O3/c1-23-7-5-21-10-12(9-18-21)19-16(22)20-14-4-6-24-15-3-2-11(17)8-13(14)15/h2-3,8-10,14H,4-7H2,1H3,(H2,19,20,22) |
| InChIKey | WEBRFJLLQJKGEO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea?
The IUPAC name of 1-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea (CID 136524628) is 1-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea.
What is the SMILES notation for 1-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea?
The canonical SMILES for 1-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea is COCCn1cc(NC(=O)NC2CCOc3ccc(F)cc32)cn1.
What is the InChIKey of 1-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea?
The InChIKey is WEBRFJLLQJKGEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19FN4O3/c1-23-7-5-21-10-12(9-18-21)19-16(22)20-14-4-6-24-15-3-2-11(17)8-13(14)15/h2-3,8-10,14H,4-7H2,1H3,(H2,19,20,22).
What are the key properties of 1-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea?
1-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea has a molecular weight of 334.35 g/mol, XLogP of 2.31, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea is sourced from PubChem (CID 136524628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).