C18H26N2O4S — CID 136527534
4-benzyl-N-(1,1-dioxothiolan-3-yl)-N-ethylmorpholine-2-carboxamide (PubChem CID 136527534) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is 4-benzyl-N-(1,1-dioxothiolan-3-yl)-N-ethylmorpholine-2-carboxamide.
| Compound Name | 4-benzyl-N-(1,1-dioxothiolan-3-yl)-N-ethylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 136527534 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 4-benzyl-N-(1,1-dioxothiolan-3-yl)-N-ethylmorpholine-2-carboxamide |
| SMILES | CCN(C(=O)C1CN(Cc2ccccc2)CCO1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H26N2O4S/c1-2-20(16-8-11-25(22,23)14-16)18(21)17-13-19(9-10-24-17)12-15-6-4-3-5-7-15/h3-7,16-17H,2,8-14H2,1H3 |
| InChIKey | LWTIOHAEMYSEDG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |