C17H22ClNO5 — CID 136528260
ethyl 1-[3-(4-chlorophenoxy)propanoyl]-4-hydroxypiperidine-4-carboxylate (PubChem CID 136528260) has the molecular formula C17H22ClNO5 and a molecular weight of 355.82 g/mol. Its IUPAC name is ethyl 1-[3-(4-chlorophenoxy)propanoyl]-4-hydroxypiperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-(4-chlorophenoxy)propanoyl]-4-hydroxypiperidine-4-carboxylate |
|---|---|
| PubChem CID | 136528260 |
| Molecular Formula | C17H22ClNO5 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | ethyl 1-[3-(4-chlorophenoxy)propanoyl]-4-hydroxypiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(O)CCN(C(=O)CCOc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H22ClNO5/c1-2-23-16(21)17(22)8-10-19(11-9-17)15(20)7-12-24-14-5-3-13(18)4-6-14/h3-6,22H,2,7-12H2,1H3 |
| InChIKey | SMRVABPFNLAIEN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |