C23H33ClN2O3 — CID 25488552
ethyl 4-[(4-chlorophenyl)methyl]-1-(3-piperidin-1-ylpropanoyl)piperidine-4-carboxylate (PubChem CID 25488552) has the molecular formula C23H33ClN2O3 and a molecular weight of 420.98 g/mol. Its IUPAC name is ethyl 4-[(4-chlorophenyl)methyl]-1-(3-piperidin-1-ylpropanoyl)piperidine-4-carboxylate.
| Compound Name | ethyl 4-[(4-chlorophenyl)methyl]-1-(3-piperidin-1-ylpropanoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 25488552 |
| Molecular Formula | C23H33ClN2O3 |
| Molecular Weight | 420.98 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | ethyl 4-[(4-chlorophenyl)methyl]-1-(3-piperidin-1-ylpropanoyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(Cc2ccc(Cl)cc2)CCN(C(=O)CCN2CCCCC2)CC1 |
| InChI | InChI=1S/C23H33ClN2O3/c1-2-29-22(28)23(18-19-6-8-20(24)9-7-19)11-16-26(17-12-23)21(27)10-15-25-13-4-3-5-14-25/h6-9H,2-5,10-18H2,1H3 |
| InChIKey | WYVPEXMACNBIIY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.98 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |