C23H26ClNO4 — CID 26325589
ethyl 4-[(4-chlorophenyl)methyl]-1-(3-methoxybenzoyl)piperidine-4-carboxylate (PubChem CID 26325589) has the molecular formula C23H26ClNO4 and a molecular weight of 415.92 g/mol. Its IUPAC name is ethyl 4-[(4-chlorophenyl)methyl]-1-(3-methoxybenzoyl)piperidine-4-carboxylate.
| Compound Name | ethyl 4-[(4-chlorophenyl)methyl]-1-(3-methoxybenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 26325589 |
| Molecular Formula | C23H26ClNO4 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | ethyl 4-[(4-chlorophenyl)methyl]-1-(3-methoxybenzoyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(Cc2ccc(Cl)cc2)CCN(C(=O)c2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C23H26ClNO4/c1-3-29-22(27)23(16-17-7-9-19(24)10-8-17)11-13-25(14-12-23)21(26)18-5-4-6-20(15-18)28-2/h4-10,15H,3,11-14,16H2,1-2H3 |
| InChIKey | CHPGJJCHISTQQJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |