C23H28ClNO4 — CID 70784822
ethyl 4-[(4-chlorophenyl)methyl]-1-[(2-hydroxy-6-methoxyphenyl)methyl]piperidine-4-carboxylate (PubChem CID 70784822) has the molecular formula C23H28ClNO4 and a molecular weight of 417.93 g/mol. Its IUPAC name is ethyl 4-[(4-chlorophenyl)methyl]-1-[(2-hydroxy-6-methoxyphenyl)methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 4-[(4-chlorophenyl)methyl]-1-[(2-hydroxy-6-methoxyphenyl)methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 70784822 |
| Molecular Formula | C23H28ClNO4 |
| Molecular Weight | 417.93 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | ethyl 4-[(4-chlorophenyl)methyl]-1-[(2-hydroxy-6-methoxyphenyl)methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(Cc2ccc(Cl)cc2)CCN(Cc2c(O)cccc2OC)CC1 |
| InChI | InChI=1S/C23H28ClNO4/c1-3-29-22(27)23(15-17-7-9-18(24)10-8-17)11-13-25(14-12-23)16-19-20(26)5-4-6-21(19)28-2/h4-10,26H,3,11-16H2,1-2H3 |
| InChIKey | DLLAZAXLLFHHOX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.93 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|