C14H23N3O2 — CID 136528518
4,6-dimethyl-N-[3-(oxan-4-yloxy)propyl]pyrimidin-2-amine (PubChem CID 136528518) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 4,6-dimethyl-N-[3-(oxan-4-yloxy)propyl]pyrimidin-2-amine.
| Compound Name | 4,6-dimethyl-N-[3-(oxan-4-yloxy)propyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 136528518 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 4,6-dimethyl-N-[3-(oxan-4-yloxy)propyl]pyrimidin-2-amine |
| SMILES | Cc1cc(C)nc(NCCCOC2CCOCC2)n1 |
| InChI | InChI=1S/C14H23N3O2/c1-11-10-12(2)17-14(16-11)15-6-3-7-19-13-4-8-18-9-5-13/h10,13H,3-9H2,1-2H3,(H,15,16,17) |
| InChIKey | ILKMGMPSYMJYRD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|