C9H15N3 — CID 21059235
4,6-dimethyl-N-propylpyrimidin-2-amine (PubChem CID 21059235) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 4,6-dimethyl-N-propylpyrimidin-2-amine.
| Compound Name | 4,6-dimethyl-N-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 21059235 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 4,6-dimethyl-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C9H15N3/c1-4-5-10-9-11-7(2)6-8(3)12-9/h6H,4-5H2,1-3H3,(H,10,11,12) |
| InChIKey | RCEPLTXOUTUECF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |