C7H10N4S — CID 747500
(4,6-dimethylpyrimidin-2-yl)thiourea (PubChem CID 747500) has the molecular formula C7H10N4S and a molecular weight of 182.25 g/mol. Its IUPAC name is (4,6-dimethylpyrimidin-2-yl)thiourea.
| Compound Name | (4,6-dimethylpyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 747500 |
| Molecular Formula | C7H10N4S |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (4,6-dimethylpyrimidin-2-yl)thiourea |
| SMILES | Cc1cc(C)nc(NC(N)=S)n1 |
| InChI | InChI=1S/C7H10N4S/c1-4-3-5(2)10-7(9-4)11-6(8)12/h3H,1-2H3,(H3,8,9,10,11,12) |
| InChIKey | HRVSCCSCURRUPW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|