C18H17N5O3 — CID 136531169
1,3,7-trimethyl-6-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolo[2,3-d]pyrimidine-2,4-dione (PubChem CID 136531169) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is 1,3,7-trimethyl-6-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolo[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1,3,7-trimethyl-6-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolo[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 136531169 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1,3,7-trimethyl-6-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolo[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1cccc(-c2noc(-c3cc4c(=O)n(C)c(=O)n(C)c4n3C)n2)c1 |
| InChI | InChI=1S/C18H17N5O3/c1-10-6-5-7-11(8-10)14-19-15(26-20-14)13-9-12-16(21(13)2)22(3)18(25)23(4)17(12)24/h5-9H,1-4H3 |
| InChIKey | MSVYPHJQCNVPLA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 87.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |