C17H30N4O2S — CID 136534603
3-(dimethylamino)-N-[2-(4-ethylpiperazin-1-yl)ethyl]-4-methylbenzenesulfonamide (PubChem CID 136534603) has the molecular formula C17H30N4O2S and a molecular weight of 354.52 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[2-(4-ethylpiperazin-1-yl)ethyl]-4-methylbenzenesulfonamide.
| Compound Name | 3-(dimethylamino)-N-[2-(4-ethylpiperazin-1-yl)ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 136534603 |
| Molecular Formula | C17H30N4O2S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 3-(dimethylamino)-N-[2-(4-ethylpiperazin-1-yl)ethyl]-4-methylbenzenesulfonamide |
| SMILES | CCN1CCN(CCNS(=O)(=O)c2ccc(C)c(N(C)C)c2)CC1 |
| InChI | InChI=1S/C17H30N4O2S/c1-5-20-10-12-21(13-11-20)9-8-18-24(22,23)16-7-6-15(2)17(14-16)19(3)4/h6-7,14,18H,5,8-13H2,1-4H3 |
| InChIKey | LEPFPXHWNFADNZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |