C9H10ClNO4S2 — CID 136534838
5-chloro-N-(oxolan-3-ylsulfonyl)thiophene-3-carboxamide (PubChem CID 136534838) has the molecular formula C9H10ClNO4S2 and a molecular weight of 295.77 g/mol. Its IUPAC name is 5-chloro-N-(oxolan-3-ylsulfonyl)thiophene-3-carboxamide.
| Compound Name | 5-chloro-N-(oxolan-3-ylsulfonyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 136534838 |
| Molecular Formula | C9H10ClNO4S2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 294.97 |
| IUPAC Name | 5-chloro-N-(oxolan-3-ylsulfonyl)thiophene-3-carboxamide |
| SMILES | O=C(NS(=O)(=O)C1CCOC1)c1csc(Cl)c1 |
| InChI | InChI=1S/C9H10ClNO4S2/c10-8-3-6(5-16-8)9(12)11-17(13,14)7-1-2-15-4-7/h3,5,7H,1-2,4H2,(H,11,12) |
| InChIKey | OAURXADQVWBVDY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |