C9H8Cl2N2O3S — CID 138986031
5,6-dichloro-N-cyclopropylsulfonylpyridine-3-carboxamide (PubChem CID 138986031) has the molecular formula C9H8Cl2N2O3S and a molecular weight of 295.15 g/mol. Its IUPAC name is 5,6-dichloro-N-cyclopropylsulfonylpyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-cyclopropylsulfonylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 138986031 |
| Molecular Formula | C9H8Cl2N2O3S |
| Molecular Weight | 295.15 g/mol |
| Exact Mass | 293.96 |
| IUPAC Name | 5,6-dichloro-N-cyclopropylsulfonylpyridine-3-carboxamide |
| SMILES | O=C(NS(=O)(=O)C1CC1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H8Cl2N2O3S/c10-7-3-5(4-12-8(7)11)9(14)13-17(15,16)6-1-2-6/h3-4,6H,1-2H2,(H,13,14) |
| InChIKey | KPKXLGSMRYKNKS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.15 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|