C11H12BrNO4S — CID 154780941
4-bromo-N-(oxolan-3-ylsulfonyl)benzamide (PubChem CID 154780941) has the molecular formula C11H12BrNO4S and a molecular weight of 334.19 g/mol. Its IUPAC name is 4-bromo-N-(oxolan-3-ylsulfonyl)benzamide.
| Compound Name | 4-bromo-N-(oxolan-3-ylsulfonyl)benzamide |
|---|---|
| PubChem CID | 154780941 |
| Molecular Formula | C11H12BrNO4S |
| Molecular Weight | 334.19 g/mol |
| Exact Mass | 332.97 |
| IUPAC Name | 4-bromo-N-(oxolan-3-ylsulfonyl)benzamide |
| SMILES | O=C(NS(=O)(=O)C1CCOC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H12BrNO4S/c12-9-3-1-8(2-4-9)11(14)13-18(15,16)10-5-6-17-7-10/h1-4,10H,5-7H2,(H,13,14) |
| InChIKey | XDNXDQVRBCCRRQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |