C16H18F3NO4S — CID 167854616
N-[(3S)-oxolan-3-yl]sulfonyl-2-[1-[4-(trifluoromethyl)phenyl]cyclopropyl]acetamide (PubChem CID 167854616) has the molecular formula C16H18F3NO4S and a molecular weight of 377.38 g/mol. Its IUPAC name is N-[(3S)-oxolan-3-yl]sulfonyl-2-[1-[4-(trifluoromethyl)phenyl]cyclopropyl]acetamide.
| Compound Name | N-[(3S)-oxolan-3-yl]sulfonyl-2-[1-[4-(trifluoromethyl)phenyl]cyclopropyl]acetamide |
|---|---|
| PubChem CID | 167854616 |
| Molecular Formula | C16H18F3NO4S |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-[(3S)-oxolan-3-yl]sulfonyl-2-[1-[4-(trifluoromethyl)phenyl]cyclopropyl]acetamide |
| SMILES | O=C(CC1(c2ccc(C(F)(F)F)cc2)CC1)NS(=O)(=O)[C@H]1CCOC1 |
| InChI | InChI=1S/C16H18F3NO4S/c17-16(18,19)12-3-1-11(2-4-12)15(6-7-15)9-14(21)20-25(22,23)13-5-8-24-10-13/h1-4,13H,5-10H2,(H,20,21)/t13-/m0/s1 |
| InChIKey | GABOCVOEHQKZIJ-ZDUSSCGKSA-N |
| XLogP | 2.36 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |