C17H26N4O6 — CID 136535442
ethyl 2-[[2-oxo-2-[3-(oxolan-3-ylmethoxy)propylamino]-1-(1H-pyrazol-5-yl)ethylidene]amino]oxyacetate (PubChem CID 136535442) has the molecular formula C17H26N4O6 and a molecular weight of 382.42 g/mol. Its IUPAC name is ethyl 2-[[2-oxo-2-[3-(oxolan-3-ylmethoxy)propylamino]-1-(1H-pyrazol-5-yl)ethylidene]amino]oxyacetate.
| Compound Name | ethyl 2-[[2-oxo-2-[3-(oxolan-3-ylmethoxy)propylamino]-1-(1H-pyrazol-5-yl)ethylidene]amino]oxyacetate |
|---|---|
| PubChem CID | 136535442 |
| Molecular Formula | C17H26N4O6 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | ethyl 2-[[2-oxo-2-[3-(oxolan-3-ylmethoxy)propylamino]-1-(1H-pyrazol-5-yl)ethylidene]amino]oxyacetate |
| SMILES | CCOC(=O)CON=C(C(=O)NCCCOCC1CCOC1)c1ccn[nH]1 |
| InChI | InChI=1S/C17H26N4O6/c1-2-26-15(22)12-27-21-16(14-4-7-19-20-14)17(23)18-6-3-8-24-10-13-5-9-25-11-13/h4,7,13H,2-3,5-6,8-12H2,1H3,(H,18,23)(H,19,20) |
| InChIKey | VAGKHXCJAHMWHZ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 124.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|