C15H23NO3S — CID 136537932
1-(3-propan-2-ylsulfonylpropyl)-3,4-dihydro-2H-quinolin-3-ol (PubChem CID 136537932) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 1-(3-propan-2-ylsulfonylpropyl)-3,4-dihydro-2H-quinolin-3-ol.
| Compound Name | 1-(3-propan-2-ylsulfonylpropyl)-3,4-dihydro-2H-quinolin-3-ol |
|---|---|
| PubChem CID | 136537932 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 1-(3-propan-2-ylsulfonylpropyl)-3,4-dihydro-2H-quinolin-3-ol |
| SMILES | CC(C)S(=O)(=O)CCCN1CC(O)Cc2ccccc21 |
| InChI | InChI=1S/C15H23NO3S/c1-12(2)20(18,19)9-5-8-16-11-14(17)10-13-6-3-4-7-15(13)16/h3-4,6-7,12,14,17H,5,8-11H2,1-2H3 |
| InChIKey | ASIWZPPSWQVDCT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |