C13H19N3O3S — CID 136537954
N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(3-methoxypiperidin-1-yl)-2-oxoacetamide (PubChem CID 136537954) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(3-methoxypiperidin-1-yl)-2-oxoacetamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(3-methoxypiperidin-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 136537954 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(3-methoxypiperidin-1-yl)-2-oxoacetamide |
| SMILES | COC1CCCN(C(=O)C(=O)Nc2nc(C)c(C)s2)C1 |
| InChI | InChI=1S/C13H19N3O3S/c1-8-9(2)20-13(14-8)15-11(17)12(18)16-6-4-5-10(7-16)19-3/h10H,4-7H2,1-3H3,(H,14,15,17) |
| InChIKey | AXUDSJIVUVAJGY-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|