C12H20N4OS2 — CID 91242212
1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-(1-methylsulfanylpiperidin-3-yl)urea (PubChem CID 91242212) has the molecular formula C12H20N4OS2 and a molecular weight of 300.45 g/mol. Its IUPAC name is 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-(1-methylsulfanylpiperidin-3-yl)urea.
| Compound Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-(1-methylsulfanylpiperidin-3-yl)urea |
|---|---|
| PubChem CID | 91242212 |
| Molecular Formula | C12H20N4OS2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-(1-methylsulfanylpiperidin-3-yl)urea |
| SMILES | CSN1CCCC(NC(=O)Nc2nc(C)c(C)s2)C1 |
| InChI | InChI=1S/C12H20N4OS2/c1-8-9(2)19-12(13-8)15-11(17)14-10-5-4-6-16(7-10)18-3/h10H,4-7H2,1-3H3,(H2,13,14,15,17) |
| InChIKey | JVKUYLJSMPITJZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|