C20H26N4O — CID 136541464
2-[methyl(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)amino]-2-phenylcyclohexan-1-one (PubChem CID 136541464) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is 2-[methyl(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)amino]-2-phenylcyclohexan-1-one.
| Compound Name | 2-[methyl(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)amino]-2-phenylcyclohexan-1-one |
|---|---|
| PubChem CID | 136541464 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 2-[methyl(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)amino]-2-phenylcyclohexan-1-one |
| SMILES | CN(Cc1nnc2n1CCCC2)C1(c2ccccc2)CCCCC1=O |
| InChI | InChI=1S/C20H26N4O/c1-23(15-19-22-21-18-12-6-8-14-24(18)19)20(13-7-5-11-17(20)25)16-9-3-2-4-10-16/h2-4,9-10H,5-8,11-15H2,1H3 |
| InChIKey | OBNWORUQLXUYTI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |