C13H21N3O3S — CID 136542586
1-tert-butyl-5-methyl-N-(1-methylcyclopropyl)sulfonylpyrazole-4-carboxamide (PubChem CID 136542586) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 1-tert-butyl-5-methyl-N-(1-methylcyclopropyl)sulfonylpyrazole-4-carboxamide.
| Compound Name | 1-tert-butyl-5-methyl-N-(1-methylcyclopropyl)sulfonylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 136542586 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1-tert-butyl-5-methyl-N-(1-methylcyclopropyl)sulfonylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NS(=O)(=O)C2(C)CC2)cnn1C(C)(C)C |
| InChI | InChI=1S/C13H21N3O3S/c1-9-10(8-14-16(9)12(2,3)4)11(17)15-20(18,19)13(5)6-7-13/h8H,6-7H2,1-5H3,(H,15,17) |
| InChIKey | MKDJNRDQJJAHOB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |