C15H19N3O3S — CID 136542782
N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)-2-oxoacetamide (PubChem CID 136542782) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)-2-oxoacetamide.
| Compound Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 136542782 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)-2-oxoacetamide |
| SMILES | O=C(Nc1nc(C2CC2)cs1)C(=O)N1C2CCC1CC(O)C2 |
| InChI | InChI=1S/C15H19N3O3S/c19-11-5-9-3-4-10(6-11)18(9)14(21)13(20)17-15-16-12(7-22-15)8-1-2-8/h7-11,19H,1-6H2,(H,16,17,20) |
| InChIKey | IRTLVNMIOUHQOF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|