C10H10Cl2N2OS — CID 33302453
(1S)-2,2-dichloro-N-(4-cyclopropyl-1,3-thiazol-2-yl)cyclopropane-1-carboxamide (PubChem CID 33302453) has the molecular formula C10H10Cl2N2OS and a molecular weight of 277.18 g/mol. Its IUPAC name is (1S)-2,2-dichloro-N-(4-cyclopropyl-1,3-thiazol-2-yl)cyclopropane-1-carboxamide.
| Compound Name | (1S)-2,2-dichloro-N-(4-cyclopropyl-1,3-thiazol-2-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 33302453 |
| Molecular Formula | C10H10Cl2N2OS |
| Molecular Weight | 277.18 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | (1S)-2,2-dichloro-N-(4-cyclopropyl-1,3-thiazol-2-yl)cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1nc(C2CC2)cs1)[C@@H]1CC1(Cl)Cl |
| InChI | InChI=1S/C10H10Cl2N2OS/c11-10(12)3-6(10)8(15)14-9-13-7(4-16-9)5-1-2-5/h4-6H,1-3H2,(H,13,14,15)/t6-/m0/s1 |
| InChIKey | UQUUQBIDOCIAAU-LURJTMIESA-N |
| XLogP | 3.15 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.18 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|