C19H23F3N4O — CID 136543370
2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-1-[4-(2-phenylethyl)piperazin-1-yl]ethanone (PubChem CID 136543370) has the molecular formula C19H23F3N4O and a molecular weight of 380.41 g/mol. Its IUPAC name is 2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-1-[4-(2-phenylethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-1-[4-(2-phenylethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 136543370 |
| Molecular Formula | C19H23F3N4O |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-1-[4-(2-phenylethyl)piperazin-1-yl]ethanone |
| SMILES | Cc1cc(C(F)(F)F)nn1CC(=O)N1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C19H23F3N4O/c1-15-13-17(19(20,21)22)23-26(15)14-18(27)25-11-9-24(10-12-25)8-7-16-5-3-2-4-6-16/h2-6,13H,7-12,14H2,1H3 |
| InChIKey | NRPBIAUJNCWGSW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |