C14H18F3N5OS — CID 141162013
2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-1-[4-(3H-1,2-thiazol-2-yl)piperazin-1-yl]ethanone (PubChem CID 141162013) has the molecular formula C14H18F3N5OS and a molecular weight of 361.39 g/mol. Its IUPAC name is 2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-1-[4-(3H-1,2-thiazol-2-yl)piperazin-1-yl]ethanone.
| Compound Name | 2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-1-[4-(3H-1,2-thiazol-2-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 141162013 |
| Molecular Formula | C14H18F3N5OS |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-1-[4-(3H-1,2-thiazol-2-yl)piperazin-1-yl]ethanone |
| SMILES | Cc1cc(C(F)(F)F)nn1CC(=O)N1CCN(N2CC=CS2)CC1 |
| InChI | InChI=1S/C14H18F3N5OS/c1-11-9-12(14(15,16)17)18-21(11)10-13(23)19-4-6-20(7-5-19)22-3-2-8-24-22/h2,8-9H,3-7,10H2,1H3 |
| InChIKey | JUMVIUQTEHCBCH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|