C13H19F3N4OS2 — CID 87569282
1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetyl]piperidine-4-carbothioamide;sulfane (PubChem CID 87569282) has the molecular formula C13H19F3N4OS2 and a molecular weight of 368.45 g/mol. Its IUPAC name is 1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetyl]piperidine-4-carbothioamide;sulfane.
| Compound Name | 1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetyl]piperidine-4-carbothioamide;sulfane |
|---|---|
| PubChem CID | 87569282 |
| Molecular Formula | C13H19F3N4OS2 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetyl]piperidine-4-carbothioamide;sulfane |
| SMILES | Cc1cc(C(F)(F)F)nn1CC(=O)N1CCC(C(N)=S)CC1.S |
| InChI | InChI=1S/C13H17F3N4OS.H2S/c1-8-6-10(13(14,15)16)18-20(8)7-11(21)19-4-2-9(3-5-19)12(17)22;/h6,9H,2-5,7H2,1H3,(H2,17,22);1H2 |
| InChIKey | NZGNTWLTPOSTCF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|