C12H16F3N5OS — CID 87557610
4-carbamothioyl-N-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]piperidine-1-carboxamide (PubChem CID 87557610) has the molecular formula C12H16F3N5OS and a molecular weight of 335.36 g/mol. Its IUPAC name is 4-carbamothioyl-N-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]piperidine-1-carboxamide.
| Compound Name | 4-carbamothioyl-N-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 87557610 |
| Molecular Formula | C12H16F3N5OS |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 4-carbamothioyl-N-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]piperidine-1-carboxamide |
| SMILES | Cc1cc(C(F)(F)F)nn1NC(=O)N1CCC(C(N)=S)CC1 |
| InChI | InChI=1S/C12H16F3N5OS/c1-7-6-9(12(13,14)15)17-20(7)18-11(21)19-4-2-8(3-5-19)10(16)22/h6,8H,2-5H2,1H3,(H2,16,22)(H,18,21) |
| InChIKey | WOYQDXORLSZKFC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|