C20H28N4O3 — CID 136543832
N-[(1-benzylazepan-3-yl)methyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 136543832) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-[(1-benzylazepan-3-yl)methyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-[(1-benzylazepan-3-yl)methyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 136543832 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | N-[(1-benzylazepan-3-yl)methyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CN1CC(=O)N(CC(=O)NCC2CCCCN(Cc3ccccc3)C2)C1=O |
| InChI | InChI=1S/C20H28N4O3/c1-22-15-19(26)24(20(22)27)14-18(25)21-11-17-9-5-6-10-23(13-17)12-16-7-3-2-4-8-16/h2-4,7-8,17H,5-6,9-15H2,1H3,(H,21,25) |
| InChIKey | UXWLPJMBMYKZLI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|