C20H32N4O2 — CID 136582146
(2S)-2-[(1-benzylazepan-3-yl)methylcarbamoylamino]-N,N-dimethylpropanamide (PubChem CID 136582146) has the molecular formula C20H32N4O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is (2S)-2-[(1-benzylazepan-3-yl)methylcarbamoylamino]-N,N-dimethylpropanamide.
| Compound Name | (2S)-2-[(1-benzylazepan-3-yl)methylcarbamoylamino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 136582146 |
| Molecular Formula | C20H32N4O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | (2S)-2-[(1-benzylazepan-3-yl)methylcarbamoylamino]-N,N-dimethylpropanamide |
| SMILES | C[C@H](NC(=O)NCC1CCCCN(Cc2ccccc2)C1)C(=O)N(C)C |
| InChI | InChI=1S/C20H32N4O2/c1-16(19(25)23(2)3)22-20(26)21-13-18-11-7-8-12-24(15-18)14-17-9-5-4-6-10-17/h4-6,9-10,16,18H,7-8,11-15H2,1-3H3,(H2,21,22,26)/t16-,18?/m0/s1 |
| InChIKey | WPERFUBXEDIVMJ-ATNAJCNCSA-N |
| XLogP | 2.06 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |