C16H21N5O2 — CID 136556926
N-(3-carbamoyl-4-methylphenyl)-1-[2-(dimethylamino)ethyl]pyrazole-4-carboxamide (PubChem CID 136556926) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is N-(3-carbamoyl-4-methylphenyl)-1-[2-(dimethylamino)ethyl]pyrazole-4-carboxamide.
| Compound Name | N-(3-carbamoyl-4-methylphenyl)-1-[2-(dimethylamino)ethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 136556926 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | N-(3-carbamoyl-4-methylphenyl)-1-[2-(dimethylamino)ethyl]pyrazole-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cnn(CCN(C)C)c2)cc1C(N)=O |
| InChI | InChI=1S/C16H21N5O2/c1-11-4-5-13(8-14(11)15(17)22)19-16(23)12-9-18-21(10-12)7-6-20(2)3/h4-5,8-10H,6-7H2,1-3H3,(H2,17,22)(H,19,23) |
| InChIKey | OBJSERLGMKXYAB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |